C31H35F3N2O5 — CID 70341018
[3-[8a-hydroxy-6-[methyl-[(E)-3-[3-(trifluoromethoxy)phenyl]prop-2-enoyl]amino]-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-4a-yl]phenyl] acetate (PubChem CID 70341018) has the molecular formula C31H35F3N2O5 and a molecular weight of 572.62 g/mol. Its IUPAC name is [3-[8a-hydroxy-6-[methyl-[(E)-3-[3-(trifluoromethoxy)phenyl]prop-2-enoyl]amino]-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-4a-yl]phenyl] acetate.
| Compound Name | [3-[8a-hydroxy-6-[methyl-[(E)-3-[3-(trifluoromethoxy)phenyl]prop-2-enoyl]amino]-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-4a-yl]phenyl] acetate |
|---|---|
| PubChem CID | 70341018 |
| Molecular Formula | C31H35F3N2O5 |
| Molecular Weight | 572.62 g/mol |
| Exact Mass | 572.25 |
| IUPAC Name | [3-[8a-hydroxy-6-[methyl-[(E)-3-[3-(trifluoromethoxy)phenyl]prop-2-enoyl]amino]-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-4a-yl]phenyl] acetate |
| SMILES | C=CCN1CCC2(c3cccc(OC(C)=O)c3)CC(N(C)C(=O)/C=C/c3cccc(OC(F)(F)F)c3)CCC2(O)C1 |
| InChI | InChI=1S/C31H35F3N2O5/c1-4-16-36-17-15-29(24-8-6-9-26(19-24)40-22(2)37)20-25(13-14-30(29,39)21-36)35(3)28(38)12-11-23-7-5-10-27(18-23)41-31(32,33)34/h4-12,18-19,25,39H,1,13-17,20-21H2,2-3H3/b12-11+ |
| InChIKey | SDRSJHCYOOQVCJ-VAWYXSNFSA-N |
| XLogP | 5.10 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.62 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|