C32H37F3N2O4 — CID 70340211
[3-[2-(cyclopropylmethyl)-6-[methyl-[(E)-3-[3-(trifluoromethoxy)phenyl]prop-2-enoyl]amino]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]phenyl] acetate (PubChem CID 70340211) has the molecular formula C32H37F3N2O4 and a molecular weight of 570.65 g/mol. Its IUPAC name is [3-[2-(cyclopropylmethyl)-6-[methyl-[(E)-3-[3-(trifluoromethoxy)phenyl]prop-2-enoyl]amino]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]phenyl] acetate.
| Compound Name | [3-[2-(cyclopropylmethyl)-6-[methyl-[(E)-3-[3-(trifluoromethoxy)phenyl]prop-2-enoyl]amino]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]phenyl] acetate |
|---|---|
| PubChem CID | 70340211 |
| Molecular Formula | C32H37F3N2O4 |
| Molecular Weight | 570.65 g/mol |
| Exact Mass | 570.27 |
| IUPAC Name | [3-[2-(cyclopropylmethyl)-6-[methyl-[(E)-3-[3-(trifluoromethoxy)phenyl]prop-2-enoyl]amino]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C23CCN(CC4CC4)CC2CCC(N(C)C(=O)/C=C/c2cccc(OC(F)(F)F)c2)C3)c1 |
| InChI | InChI=1S/C32H37F3N2O4/c1-22(38)40-28-7-4-6-25(18-28)31-15-16-37(20-24-9-10-24)21-26(31)12-13-27(19-31)36(2)30(39)14-11-23-5-3-8-29(17-23)41-32(33,34)35/h3-8,11,14,17-18,24,26-27H,9-10,12-13,15-16,19-21H2,1-2H3/b14-11+ |
| InChIKey | NQMZAVVYJPVLIS-SDNWHVSQSA-N |
| XLogP | 6.20 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.65 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|