C30H38N2O3 — CID 70341202
(E)-N-[2-(cyclopropylmethyl)-4a-(3-methoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-3-(3-hydroxyphenyl)-N-methylprop-2-enamide (PubChem CID 70341202) has the molecular formula C30H38N2O3 and a molecular weight of 474.65 g/mol. Its IUPAC name is (E)-N-[2-(cyclopropylmethyl)-4a-(3-methoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-3-(3-hydroxyphenyl)-N-methylprop-2-enamide.
| Compound Name | (E)-N-[2-(cyclopropylmethyl)-4a-(3-methoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-3-(3-hydroxyphenyl)-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 70341202 |
| Molecular Formula | C30H38N2O3 |
| Molecular Weight | 474.65 g/mol |
| Exact Mass | 474.29 |
| IUPAC Name | (E)-N-[2-(cyclopropylmethyl)-4a-(3-methoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-3-(3-hydroxyphenyl)-N-methylprop-2-enamide |
| SMILES | COc1cccc(C23CCN(CC4CC4)CC2CCC(N(C)C(=O)/C=C/c2cccc(O)c2)C3)c1 |
| InChI | InChI=1S/C30H38N2O3/c1-31(29(34)14-11-22-5-3-7-27(33)17-22)26-13-12-25-21-32(20-23-9-10-23)16-15-30(25,19-26)24-6-4-8-28(18-24)35-2/h3-8,11,14,17-18,23,25-26,33H,9-10,12-13,15-16,19-21H2,1-2H3/b14-11+ |
| InChIKey | RCNNYZMBYMLYLW-SDNWHVSQSA-N |
| XLogP | 5.09 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.65 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|