C29H36N2O3 — CID 70338010
N-[(4aR,6S,8aS)-2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-3-(3-methoxyphenyl)prop-2-enamide (PubChem CID 70338010) has the molecular formula C29H36N2O3 and a molecular weight of 460.62 g/mol. Its IUPAC name is N-[(4aR,6S,8aS)-2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-3-(3-methoxyphenyl)prop-2-enamide.
| Compound Name | N-[(4aR,6S,8aS)-2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-3-(3-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 70338010 |
| Molecular Formula | C29H36N2O3 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.27 |
| IUPAC Name | N-[(4aR,6S,8aS)-2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-3-(3-methoxyphenyl)prop-2-enamide |
| SMILES | COc1cccc(C=CC(=O)N[C@H]2CC[C@@H]3CN(CC4CC4)CC[C@@]3(c3cccc(O)c3)C2)c1 |
| InChI | InChI=1S/C29H36N2O3/c1-34-27-7-2-4-21(16-27)10-13-28(33)30-25-12-11-24-20-31(19-22-8-9-22)15-14-29(24,18-25)23-5-3-6-26(32)17-23/h2-7,10,13,16-17,22,24-25,32H,8-9,11-12,14-15,18-20H2,1H3,(H,30,33)/t24-,25+,29+/m1/s1 |
| InChIKey | BCMCEQZXXWCHQM-AHPZMPFVSA-N |
| XLogP | 4.75 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|