C26H32N2O2 — CID 70336222
N-[(6R)-2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]benzamide (PubChem CID 70336222) has the molecular formula C26H32N2O2 and a molecular weight of 404.55 g/mol. Its IUPAC name is N-[(6R)-2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]benzamide.
| Compound Name | N-[(6R)-2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]benzamide |
|---|---|
| PubChem CID | 70336222 |
| Molecular Formula | C26H32N2O2 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.25 |
| IUPAC Name | N-[(6R)-2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]benzamide |
| SMILES | O=C(N[C@@H]1CCC2CN(CC3CC3)CCC2(c2cccc(O)c2)C1)c1ccccc1 |
| InChI | InChI=1S/C26H32N2O2/c29-24-8-4-7-21(15-24)26-13-14-28(17-19-9-10-19)18-22(26)11-12-23(16-26)27-25(30)20-5-2-1-3-6-20/h1-8,15,19,22-23,29H,9-14,16-18H2,(H,27,30)/t22?,23-,26?/m1/s1 |
| InChIKey | SZZIYYUEISFGKZ-VVCJCJSVSA-N |
| XLogP | 4.34 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |