C20H32NO5P — CID 21330537
3-[2-(cyclobutylmethyl)-1,3,4,5,6,7,8,8a-octahydrocyclopenta[c]azepin-5a-yl]phenol;phosphoric acid (PubChem CID 21330537) has the molecular formula C20H32NO5P and a molecular weight of 397.45 g/mol. Its IUPAC name is 3-[2-(cyclobutylmethyl)-1,3,4,5,6,7,8,8a-octahydrocyclopenta[c]azepin-5a-yl]phenol;phosphoric acid.
| Compound Name | 3-[2-(cyclobutylmethyl)-1,3,4,5,6,7,8,8a-octahydrocyclopenta[c]azepin-5a-yl]phenol;phosphoric acid |
|---|---|
| PubChem CID | 21330537 |
| Molecular Formula | C20H32NO5P |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | 3-[2-(cyclobutylmethyl)-1,3,4,5,6,7,8,8a-octahydrocyclopenta[c]azepin-5a-yl]phenol;phosphoric acid |
| SMILES | O=P(O)(O)O.Oc1cccc(C23CCCC2CN(CC2CCC2)CCC3)c1 |
| InChI | InChI=1S/C20H29NO.H3O4P/c22-19-9-2-7-17(13-19)20-10-3-8-18(20)15-21(12-4-11-20)14-16-5-1-6-16;1-5(2,3)4/h2,7,9,13,16,18,22H,1,3-6,8,10-12,14-15H2;(H3,1,2,3,4) |
| InChIKey | DAULYEKOPWYLPO-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 101.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|