C26H32N2O3 — CID 56998996
benzyl N-[(4aR,6S,8aS)-4a-(3-hydroxyphenyl)-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]carbamate (PubChem CID 56998996) has the molecular formula C26H32N2O3 and a molecular weight of 420.55 g/mol. Its IUPAC name is benzyl N-[(4aR,6S,8aS)-4a-(3-hydroxyphenyl)-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]carbamate.
| Compound Name | benzyl N-[(4aR,6S,8aS)-4a-(3-hydroxyphenyl)-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]carbamate |
|---|---|
| PubChem CID | 56998996 |
| Molecular Formula | C26H32N2O3 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | benzyl N-[(4aR,6S,8aS)-4a-(3-hydroxyphenyl)-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]carbamate |
| SMILES | C=CCN1CC[C@@]2(c3cccc(O)c3)C[C@@H](NC(=O)OCc3ccccc3)CC[C@@H]2C1 |
| InChI | InChI=1S/C26H32N2O3/c1-2-14-28-15-13-26(21-9-6-10-24(29)16-21)17-23(12-11-22(26)18-28)27-25(30)31-19-20-7-4-3-5-8-20/h2-10,16,22-23,29H,1,11-15,17-19H2,(H,27,30)/t22-,23+,26+/m1/s1 |
| InChIKey | PXQYIQBLQMXYTM-UMFSSWHCSA-N |
| XLogP | 4.62 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|