C27H34N2O3 — CID 57160452
benzyl N-[(4aR,6S,8aS)-4a-(3-methoxyphenyl)-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]carbamate (PubChem CID 57160452) has the molecular formula C27H34N2O3 and a molecular weight of 434.58 g/mol. Its IUPAC name is benzyl N-[(4aR,6S,8aS)-4a-(3-methoxyphenyl)-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]carbamate.
| Compound Name | benzyl N-[(4aR,6S,8aS)-4a-(3-methoxyphenyl)-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]carbamate |
|---|---|
| PubChem CID | 57160452 |
| Molecular Formula | C27H34N2O3 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.26 |
| IUPAC Name | benzyl N-[(4aR,6S,8aS)-4a-(3-methoxyphenyl)-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]carbamate |
| SMILES | C=CCN1CC[C@@]2(c3cccc(OC)c3)C[C@@H](NC(=O)OCc3ccccc3)CC[C@@H]2C1 |
| InChI | InChI=1S/C27H34N2O3/c1-3-15-29-16-14-27(22-10-7-11-25(17-22)31-2)18-24(13-12-23(27)19-29)28-26(30)32-20-21-8-5-4-6-9-21/h3-11,17,23-24H,1,12-16,18-20H2,2H3,(H,28,30)/t23-,24+,27+/m1/s1 |
| InChIKey | GYWKCOYGWXZQMC-DXBVXKBHSA-N |
| XLogP | 4.92 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|