C27H31BrN2O3S — CID 18661859
[3-[(4aR,6S,8aS)-6-[[(E)-3-(4-bromothiophen-2-yl)prop-2-enoyl]amino]-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]phenyl] acetate (PubChem CID 18661859) has the molecular formula C27H31BrN2O3S and a molecular weight of 543.53 g/mol. Its IUPAC name is [3-[(4aR,6S,8aS)-6-[[(E)-3-(4-bromothiophen-2-yl)prop-2-enoyl]amino]-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]phenyl] acetate.
| Compound Name | [3-[(4aR,6S,8aS)-6-[[(E)-3-(4-bromothiophen-2-yl)prop-2-enoyl]amino]-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]phenyl] acetate |
|---|---|
| PubChem CID | 18661859 |
| Molecular Formula | C27H31BrN2O3S |
| Molecular Weight | 543.53 g/mol |
| Exact Mass | 542.12 |
| IUPAC Name | [3-[(4aR,6S,8aS)-6-[[(E)-3-(4-bromothiophen-2-yl)prop-2-enoyl]amino]-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]phenyl] acetate |
| SMILES | C=CCN1CC[C@@]2(c3cccc(OC(C)=O)c3)C[C@@H](NC(=O)/C=C/c3cc(Br)cs3)CC[C@@H]2C1 |
| InChI | InChI=1S/C27H31BrN2O3S/c1-3-12-30-13-11-27(20-5-4-6-24(14-20)33-19(2)31)16-23(8-7-21(27)17-30)29-26(32)10-9-25-15-22(28)18-34-25/h3-6,9-10,14-15,18,21,23H,1,7-8,11-13,16-17H2,2H3,(H,29,32)/b10-9+/t21-,23+,27+/m1/s1 |
| InChIKey | NZUXVYLSKDHPAW-ZQNKJLMYSA-N |
| XLogP | 5.56 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.53 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|