C35H50N2O2 — CID 70338185
N-[(4aR,6S,8aS)-4a-(3-methoxyphenyl)-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-N-(2-methylpropyl)-6-phenylhexanamide (PubChem CID 70338185) has the molecular formula C35H50N2O2 and a molecular weight of 530.80 g/mol. Its IUPAC name is N-[(4aR,6S,8aS)-4a-(3-methoxyphenyl)-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-N-(2-methylpropyl)-6-phenylhexanamide.
| Compound Name | N-[(4aR,6S,8aS)-4a-(3-methoxyphenyl)-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-N-(2-methylpropyl)-6-phenylhexanamide |
|---|---|
| PubChem CID | 70338185 |
| Molecular Formula | C35H50N2O2 |
| Molecular Weight | 530.80 g/mol |
| Exact Mass | 530.39 |
| IUPAC Name | N-[(4aR,6S,8aS)-4a-(3-methoxyphenyl)-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-N-(2-methylpropyl)-6-phenylhexanamide |
| SMILES | C=CCN1CC[C@@]2(c3cccc(OC)c3)C[C@@H](N(CC(C)C)C(=O)CCCCCc3ccccc3)CC[C@@H]2C1 |
| InChI | InChI=1S/C35H50N2O2/c1-5-22-36-23-21-35(30-16-12-17-33(24-30)39-4)25-32(20-19-31(35)27-36)37(26-28(2)3)34(38)18-11-7-10-15-29-13-8-6-9-14-29/h5-6,8-9,12-14,16-17,24,28,31-32H,1,7,10-11,15,18-23,25-27H2,2-4H3/t31-,32+,35+/m1/s1 |
| InChIKey | YDKPXIVMVGOCOC-RASJINCSSA-N |
| XLogP | 7.28 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.80 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|