C36H50N2O4 — CID 70336783
[4a-(3-hydroxyphenyl)-6-[2-methylpropyl(6-phenylhexanoyl)amino]-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-8a-yl] acetate (PubChem CID 70336783) has the molecular formula C36H50N2O4 and a molecular weight of 574.81 g/mol. Its IUPAC name is [4a-(3-hydroxyphenyl)-6-[2-methylpropyl(6-phenylhexanoyl)amino]-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-8a-yl] acetate.
| Compound Name | [4a-(3-hydroxyphenyl)-6-[2-methylpropyl(6-phenylhexanoyl)amino]-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-8a-yl] acetate |
|---|---|
| PubChem CID | 70336783 |
| Molecular Formula | C36H50N2O4 |
| Molecular Weight | 574.81 g/mol |
| Exact Mass | 574.38 |
| IUPAC Name | [4a-(3-hydroxyphenyl)-6-[2-methylpropyl(6-phenylhexanoyl)amino]-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-8a-yl] acetate |
| SMILES | C=CCN1CCC2(c3cccc(O)c3)CC(N(CC(C)C)C(=O)CCCCCc3ccccc3)CCC2(OC(C)=O)C1 |
| InChI | InChI=1S/C36H50N2O4/c1-5-22-37-23-21-35(31-16-12-17-33(40)24-31)25-32(19-20-36(35,27-37)42-29(4)39)38(26-28(2)3)34(41)18-11-7-10-15-30-13-8-6-9-14-30/h5-6,8-9,12-14,16-17,24,28,32,40H,1,7,10-11,15,18-23,25-27H2,2-4H3 |
| InChIKey | HJDUICSOOKAXMI-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.81 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|