C32H42N2O4 — CID 19071724
[6-[benzoyl(2-methylpropyl)amino]-4a-(3-methoxyphenyl)-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-8a-yl] acetate (PubChem CID 19071724) has the molecular formula C32H42N2O4 and a molecular weight of 518.70 g/mol. Its IUPAC name is [6-[benzoyl(2-methylpropyl)amino]-4a-(3-methoxyphenyl)-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-8a-yl] acetate.
| Compound Name | [6-[benzoyl(2-methylpropyl)amino]-4a-(3-methoxyphenyl)-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-8a-yl] acetate |
|---|---|
| PubChem CID | 19071724 |
| Molecular Formula | C32H42N2O4 |
| Molecular Weight | 518.70 g/mol |
| Exact Mass | 518.31 |
| IUPAC Name | [6-[benzoyl(2-methylpropyl)amino]-4a-(3-methoxyphenyl)-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-8a-yl] acetate |
| SMILES | C=CCN1CCC2(c3cccc(OC)c3)CC(N(CC(C)C)C(=O)c3ccccc3)CCC2(OC(C)=O)C1 |
| InChI | InChI=1S/C32H42N2O4/c1-6-18-33-19-17-31(27-13-10-14-29(20-27)37-5)21-28(15-16-32(31,23-33)38-25(4)35)34(22-24(2)3)30(36)26-11-8-7-9-12-26/h6-14,20,24,28H,1,15-19,21-23H2,2-5H3 |
| InChIKey | MDXJOXKRZHMSKY-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.70 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|