C29H38N2O3 — CID 18662072
N-[(4aS,6R,8aR)-8a-hydroxy-4a-(3-hydroxyphenyl)-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-N-(2-methylpropyl)benzamide (PubChem CID 18662072) has the molecular formula C29H38N2O3 and a molecular weight of 462.63 g/mol. Its IUPAC name is N-[(4aS,6R,8aR)-8a-hydroxy-4a-(3-hydroxyphenyl)-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-N-(2-methylpropyl)benzamide.
| Compound Name | N-[(4aS,6R,8aR)-8a-hydroxy-4a-(3-hydroxyphenyl)-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-N-(2-methylpropyl)benzamide |
|---|---|
| PubChem CID | 18662072 |
| Molecular Formula | C29H38N2O3 |
| Molecular Weight | 462.63 g/mol |
| Exact Mass | 462.29 |
| IUPAC Name | N-[(4aS,6R,8aR)-8a-hydroxy-4a-(3-hydroxyphenyl)-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-N-(2-methylpropyl)benzamide |
| SMILES | C=CCN1CC[C@@]2(c3cccc(O)c3)C[C@H](N(CC(C)C)C(=O)c3ccccc3)CC[C@]2(O)C1 |
| InChI | InChI=1S/C29H38N2O3/c1-4-16-30-17-15-28(24-11-8-12-26(32)18-24)19-25(13-14-29(28,34)21-30)31(20-22(2)3)27(33)23-9-6-5-7-10-23/h4-12,18,22,25,32,34H,1,13-17,19-21H2,2-3H3/t25-,28+,29+/m1/s1 |
| InChIKey | ZJAITYBZMCHRFG-IGBKUBFESA-N |
| XLogP | 4.60 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.63 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|