C32H42N2O4 — CID 57237582
[6-[benzoyl(2-methylpropyl)amino]-2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-8a-yl] acetate (PubChem CID 57237582) has the molecular formula C32H42N2O4 and a molecular weight of 518.70 g/mol. Its IUPAC name is [6-[benzoyl(2-methylpropyl)amino]-2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-8a-yl] acetate.
| Compound Name | [6-[benzoyl(2-methylpropyl)amino]-2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-8a-yl] acetate |
|---|---|
| PubChem CID | 57237582 |
| Molecular Formula | C32H42N2O4 |
| Molecular Weight | 518.70 g/mol |
| Exact Mass | 518.31 |
| IUPAC Name | [6-[benzoyl(2-methylpropyl)amino]-2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-8a-yl] acetate |
| SMILES | CC(=O)OC12CCC(N(CC(C)C)C(=O)c3ccccc3)CC1(c1cccc(O)c1)CCN(CC1CC1)C2 |
| InChI | InChI=1S/C32H42N2O4/c1-23(2)20-34(30(37)26-8-5-4-6-9-26)28-14-15-32(38-24(3)35)22-33(21-25-12-13-25)17-16-31(32,19-28)27-10-7-11-29(36)18-27/h4-11,18,23,25,28,36H,12-17,19-22H2,1-3H3 |
| InChIKey | RQQLGVKVGUENSD-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.70 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |