C31H40N2O5 — CID 18662509
[3-[(4aS,6R,8aR)-8a-acetyloxy-6-[benzoyl(2-methylpropyl)amino]-2-methyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-4a-yl]phenyl] acetate (PubChem CID 18662509) has the molecular formula C31H40N2O5 and a molecular weight of 520.67 g/mol. Its IUPAC name is [3-[(4aS,6R,8aR)-8a-acetyloxy-6-[benzoyl(2-methylpropyl)amino]-2-methyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-4a-yl]phenyl] acetate.
| Compound Name | [3-[(4aS,6R,8aR)-8a-acetyloxy-6-[benzoyl(2-methylpropyl)amino]-2-methyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-4a-yl]phenyl] acetate |
|---|---|
| PubChem CID | 18662509 |
| Molecular Formula | C31H40N2O5 |
| Molecular Weight | 520.67 g/mol |
| Exact Mass | 520.29 |
| IUPAC Name | [3-[(4aS,6R,8aR)-8a-acetyloxy-6-[benzoyl(2-methylpropyl)amino]-2-methyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-4a-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc([C@@]23CCN(C)C[C@@]2(OC(C)=O)CC[C@@H](N(CC(C)C)C(=O)c2ccccc2)C3)c1 |
| InChI | InChI=1S/C31H40N2O5/c1-22(2)20-33(29(36)25-10-7-6-8-11-25)27-14-15-31(38-24(4)35)21-32(5)17-16-30(31,19-27)26-12-9-13-28(18-26)37-23(3)34/h6-13,18,22,27H,14-17,19-21H2,1-5H3/t27-,30+,31+/m1/s1 |
| InChIKey | DQLDOMHBUMRQMK-RDAHNBDFSA-N |
| XLogP | 4.84 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.67 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|