C33H40N2O4 — CID 70339154
[3-[(4aS,6R,8aR)-8a-hydroxy-2-methyl-6-[2-methylpropyl(naphthalene-2-carbonyl)amino]-3,4,5,6,7,8-hexahydro-1H-isoquinolin-4a-yl]phenyl] acetate (PubChem CID 70339154) has the molecular formula C33H40N2O4 and a molecular weight of 528.69 g/mol. Its IUPAC name is [3-[(4aS,6R,8aR)-8a-hydroxy-2-methyl-6-[2-methylpropyl(naphthalene-2-carbonyl)amino]-3,4,5,6,7,8-hexahydro-1H-isoquinolin-4a-yl]phenyl] acetate.
| Compound Name | [3-[(4aS,6R,8aR)-8a-hydroxy-2-methyl-6-[2-methylpropyl(naphthalene-2-carbonyl)amino]-3,4,5,6,7,8-hexahydro-1H-isoquinolin-4a-yl]phenyl] acetate |
|---|---|
| PubChem CID | 70339154 |
| Molecular Formula | C33H40N2O4 |
| Molecular Weight | 528.69 g/mol |
| Exact Mass | 528.30 |
| IUPAC Name | [3-[(4aS,6R,8aR)-8a-hydroxy-2-methyl-6-[2-methylpropyl(naphthalene-2-carbonyl)amino]-3,4,5,6,7,8-hexahydro-1H-isoquinolin-4a-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc([C@@]23CCN(C)C[C@@]2(O)CC[C@@H](N(CC(C)C)C(=O)c2ccc4ccccc4c2)C3)c1 |
| InChI | InChI=1S/C33H40N2O4/c1-23(2)21-35(31(37)27-13-12-25-8-5-6-9-26(25)18-27)29-14-15-33(38)22-34(4)17-16-32(33,20-29)28-10-7-11-30(19-28)39-24(3)36/h5-13,18-19,23,29,38H,14-17,20-22H2,1-4H3/t29-,32+,33+/m1/s1 |
| InChIKey | KPFVXDWIIFWXRV-CDSZWMAJSA-N |
| XLogP | 5.42 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.69 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|