C32H40N2O3 — CID 70340930
N-[(4aS,6R,8aR)-8a-hydroxy-4a-(3-methoxyphenyl)-2-methyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-N-(2-methylpropyl)naphthalene-2-carboxamide (PubChem CID 70340930) has the molecular formula C32H40N2O3 and a molecular weight of 500.68 g/mol. Its IUPAC name is N-[(4aS,6R,8aR)-8a-hydroxy-4a-(3-methoxyphenyl)-2-methyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-N-(2-methylpropyl)naphthalene-2-carboxamide.
| Compound Name | N-[(4aS,6R,8aR)-8a-hydroxy-4a-(3-methoxyphenyl)-2-methyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-N-(2-methylpropyl)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 70340930 |
| Molecular Formula | C32H40N2O3 |
| Molecular Weight | 500.68 g/mol |
| Exact Mass | 500.30 |
| IUPAC Name | N-[(4aS,6R,8aR)-8a-hydroxy-4a-(3-methoxyphenyl)-2-methyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-N-(2-methylpropyl)naphthalene-2-carboxamide |
| SMILES | COc1cccc([C@@]23CCN(C)C[C@@]2(O)CC[C@@H](N(CC(C)C)C(=O)c2ccc4ccccc4c2)C3)c1 |
| InChI | InChI=1S/C32H40N2O3/c1-23(2)21-34(30(35)26-13-12-24-8-5-6-9-25(24)18-26)28-14-15-32(36)22-33(3)17-16-31(32,20-28)27-10-7-11-29(19-27)37-4/h5-13,18-19,23,28,36H,14-17,20-22H2,1-4H3/t28-,31+,32+/m1/s1 |
| InChIKey | TUUYNJSVGLWAIB-DPFTZIENSA-N |
| XLogP | 5.50 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.68 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |