C28H38N2O2 — CID 18662500
N-[(4aR,6S,8aS)-4a-(3-methoxyphenyl)-2-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-N-(2-methylpropyl)benzamide (PubChem CID 18662500) has the molecular formula C28H38N2O2 and a molecular weight of 434.62 g/mol. Its IUPAC name is N-[(4aR,6S,8aS)-4a-(3-methoxyphenyl)-2-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-N-(2-methylpropyl)benzamide.
| Compound Name | N-[(4aR,6S,8aS)-4a-(3-methoxyphenyl)-2-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-N-(2-methylpropyl)benzamide |
|---|---|
| PubChem CID | 18662500 |
| Molecular Formula | C28H38N2O2 |
| Molecular Weight | 434.62 g/mol |
| Exact Mass | 434.29 |
| IUPAC Name | N-[(4aR,6S,8aS)-4a-(3-methoxyphenyl)-2-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-N-(2-methylpropyl)benzamide |
| SMILES | COc1cccc([C@@]23CCN(C)C[C@H]2CC[C@H](N(CC(C)C)C(=O)c2ccccc2)C3)c1 |
| InChI | InChI=1S/C28H38N2O2/c1-21(2)19-30(27(31)22-9-6-5-7-10-22)25-14-13-24-20-29(3)16-15-28(24,18-25)23-11-8-12-26(17-23)32-4/h5-12,17,21,24-25H,13-16,18-20H2,1-4H3/t24-,25+,28+/m1/s1 |
| InChIKey | CXAANZRXAMEZEZ-QQNWGBJXSA-N |
| XLogP | 5.24 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.62 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |