C25H32N2O2 — CID 67668859
N-[(6R)-4a-(3-methoxyphenyl)-2-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-N-methylbenzamide (PubChem CID 67668859) has the molecular formula C25H32N2O2 and a molecular weight of 392.54 g/mol. Its IUPAC name is N-[(6R)-4a-(3-methoxyphenyl)-2-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-N-methylbenzamide.
| Compound Name | N-[(6R)-4a-(3-methoxyphenyl)-2-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-N-methylbenzamide |
|---|---|
| PubChem CID | 67668859 |
| Molecular Formula | C25H32N2O2 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.25 |
| IUPAC Name | N-[(6R)-4a-(3-methoxyphenyl)-2-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-N-methylbenzamide |
| SMILES | COc1cccc(C23CCN(C)CC2CC[C@@H](N(C)C(=O)c2ccccc2)C3)c1 |
| InChI | InChI=1S/C25H32N2O2/c1-26-15-14-25(20-10-7-11-23(16-20)29-3)17-22(13-12-21(25)18-26)27(2)24(28)19-8-5-4-6-9-19/h4-11,16,21-22H,12-15,17-18H2,1-3H3/t21?,22-,25?/m1/s1 |
| InChIKey | XBYQZFNWQKNESV-SMCIBBBJSA-N |
| XLogP | 4.21 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |