C31H36N2O4 — CID 67728453
[(4aR,6R,8aS)-4a-(3-methoxyphenyl)-2-methyl-6-[methyl(naphthalene-2-carbonyl)amino]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-8-yl] acetate (PubChem CID 67728453) has the molecular formula C31H36N2O4 and a molecular weight of 500.64 g/mol. Its IUPAC name is [(4aR,6R,8aS)-4a-(3-methoxyphenyl)-2-methyl-6-[methyl(naphthalene-2-carbonyl)amino]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-8-yl] acetate.
| Compound Name | [(4aR,6R,8aS)-4a-(3-methoxyphenyl)-2-methyl-6-[methyl(naphthalene-2-carbonyl)amino]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-8-yl] acetate |
|---|---|
| PubChem CID | 67728453 |
| Molecular Formula | C31H36N2O4 |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.27 |
| IUPAC Name | [(4aR,6R,8aS)-4a-(3-methoxyphenyl)-2-methyl-6-[methyl(naphthalene-2-carbonyl)amino]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-8-yl] acetate |
| SMILES | COc1cccc([C@@]23CCN(C)C[C@H]2C(OC(C)=O)C[C@H](N(C)C(=O)c2ccc4ccccc4c2)C3)c1 |
| InChI | InChI=1S/C31H36N2O4/c1-21(34)37-29-18-26(33(3)30(35)24-13-12-22-8-5-6-9-23(22)16-24)19-31(14-15-32(2)20-28(29)31)25-10-7-11-27(17-25)36-4/h5-13,16-17,26,28-29H,14-15,18-20H2,1-4H3/t26-,28-,29?,31-/m0/s1 |
| InChIKey | KXSHWSKULPHZRT-PYHAKDNVSA-N |
| XLogP | 4.90 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |