C29H34N2O3 — CID 67728354
N-[8-hydroxy-4a-(3-methoxyphenyl)-2-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-N-methylnaphthalene-2-carboxamide (PubChem CID 67728354) has the molecular formula C29H34N2O3 and a molecular weight of 458.60 g/mol. Its IUPAC name is N-[8-hydroxy-4a-(3-methoxyphenyl)-2-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-N-methylnaphthalene-2-carboxamide.
| Compound Name | N-[8-hydroxy-4a-(3-methoxyphenyl)-2-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-N-methylnaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 67728354 |
| Molecular Formula | C29H34N2O3 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | N-[8-hydroxy-4a-(3-methoxyphenyl)-2-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-N-methylnaphthalene-2-carboxamide |
| SMILES | COc1cccc(C23CCN(C)CC2C(O)CC(N(C)C(=O)c2ccc4ccccc4c2)C3)c1 |
| InChI | InChI=1S/C29H34N2O3/c1-30-14-13-29(23-9-6-10-25(16-23)34-3)18-24(17-27(32)26(29)19-30)31(2)28(33)22-12-11-20-7-4-5-8-21(20)15-22/h4-12,15-16,24,26-27,32H,13-14,17-19H2,1-3H3 |
| InChIKey | HTAYCEKCGILQFF-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |