C28H32N2O2 — CID 70336013
N-[(4aR,6S,8aS)-4a-(3-methoxyphenyl)-2-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]naphthalene-2-carboxamide (PubChem CID 70336013) has the molecular formula C28H32N2O2 and a molecular weight of 428.58 g/mol. Its IUPAC name is N-[(4aR,6S,8aS)-4a-(3-methoxyphenyl)-2-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]naphthalene-2-carboxamide.
| Compound Name | N-[(4aR,6S,8aS)-4a-(3-methoxyphenyl)-2-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 70336013 |
| Molecular Formula | C28H32N2O2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | N-[(4aR,6S,8aS)-4a-(3-methoxyphenyl)-2-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]naphthalene-2-carboxamide |
| SMILES | COc1cccc([C@@]23CCN(C)C[C@H]2CC[C@H](NC(=O)c2ccc4ccccc4c2)C3)c1 |
| InChI | InChI=1S/C28H32N2O2/c1-30-15-14-28(23-8-5-9-26(17-23)32-2)18-25(13-12-24(28)19-30)29-27(31)22-11-10-20-6-3-4-7-21(20)16-22/h3-11,16-17,24-25H,12-15,18-19H2,1-2H3,(H,29,31)/t24-,25+,28+/m1/s1 |
| InChIKey | ISPWCKUNVBNIKD-QQNWGBJXSA-N |
| XLogP | 5.02 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |