C25H30N2O4 — CID 22441219
[3-(6-benzamido-8-hydroxy-2-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl)phenyl] acetate (PubChem CID 22441219) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is [3-(6-benzamido-8-hydroxy-2-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl)phenyl] acetate.
| Compound Name | [3-(6-benzamido-8-hydroxy-2-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl)phenyl] acetate |
|---|---|
| PubChem CID | 22441219 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | [3-(6-benzamido-8-hydroxy-2-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl)phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C23CCN(C)CC2C(O)CC(NC(=O)c2ccccc2)C3)c1 |
| InChI | InChI=1S/C25H30N2O4/c1-17(28)31-21-10-6-9-19(13-21)25-11-12-27(2)16-22(25)23(29)14-20(15-25)26-24(30)18-7-4-3-5-8-18/h3-10,13,20,22-23,29H,11-12,14-16H2,1-2H3,(H,26,30) |
| InChIKey | TVBRSRPKMGDKRD-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|