C25H30Cl2N2O3 — CID 67727940
2-(3,4-dichlorophenyl)-N-[(6R)-8-hydroxy-4a-(3-methoxyphenyl)-2-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]acetamide (PubChem CID 67727940) has the molecular formula C25H30Cl2N2O3 and a molecular weight of 477.43 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-N-[(6R)-8-hydroxy-4a-(3-methoxyphenyl)-2-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]acetamide.
| Compound Name | 2-(3,4-dichlorophenyl)-N-[(6R)-8-hydroxy-4a-(3-methoxyphenyl)-2-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]acetamide |
|---|---|
| PubChem CID | 67727940 |
| Molecular Formula | C25H30Cl2N2O3 |
| Molecular Weight | 477.43 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-N-[(6R)-8-hydroxy-4a-(3-methoxyphenyl)-2-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]acetamide |
| SMILES | COc1cccc(C23CCN(C)CC2C(O)C[C@H](NC(=O)Cc2ccc(Cl)c(Cl)c2)C3)c1 |
| InChI | InChI=1S/C25H30Cl2N2O3/c1-29-9-8-25(17-4-3-5-19(12-17)32-2)14-18(13-23(30)20(25)15-29)28-24(31)11-16-6-7-21(26)22(27)10-16/h3-7,10,12,18,20,23,30H,8-9,11,13-15H2,1-2H3,(H,28,31)/t18-,20?,23?,25?/m0/s1 |
| InChIKey | QTEUCUNAAROPBT-LWTPLLIUSA-N |
| XLogP | 4.07 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.43 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |