C31H40Cl2N2O4 — CID 67728639
[6-[[2-(3,4-dichlorophenyl)acetyl]-(2-methylpropyl)amino]-4a-(3-methoxyphenyl)-2-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-8-yl] acetate (PubChem CID 67728639) has the molecular formula C31H40Cl2N2O4 and a molecular weight of 575.58 g/mol. Its IUPAC name is [6-[[2-(3,4-dichlorophenyl)acetyl]-(2-methylpropyl)amino]-4a-(3-methoxyphenyl)-2-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-8-yl] acetate.
| Compound Name | [6-[[2-(3,4-dichlorophenyl)acetyl]-(2-methylpropyl)amino]-4a-(3-methoxyphenyl)-2-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-8-yl] acetate |
|---|---|
| PubChem CID | 67728639 |
| Molecular Formula | C31H40Cl2N2O4 |
| Molecular Weight | 575.58 g/mol |
| Exact Mass | 574.24 |
| IUPAC Name | [6-[[2-(3,4-dichlorophenyl)acetyl]-(2-methylpropyl)amino]-4a-(3-methoxyphenyl)-2-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-8-yl] acetate |
| SMILES | COc1cccc(C23CCN(C)CC2C(OC(C)=O)CC(N(CC(C)C)C(=O)Cc2ccc(Cl)c(Cl)c2)C3)c1 |
| InChI | InChI=1S/C31H40Cl2N2O4/c1-20(2)18-35(30(37)14-22-9-10-27(32)28(33)13-22)24-16-29(39-21(3)36)26-19-34(4)12-11-31(26,17-24)23-7-6-8-25(15-23)38-5/h6-10,13,15,20,24,26,29H,11-12,14,16-19H2,1-5H3 |
| InChIKey | KCLQWUYDCVVYKG-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.58 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |