C32H42Cl2N2O3 — CID 67728718
N-[(4aR,6R,8aS)-2-(cyclopropylmethyl)-8-hydroxy-4a-(3-methoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-2-(3,4-dichlorophenyl)-N-(2-methylpropyl)acetamide (PubChem CID 67728718) has the molecular formula C32H42Cl2N2O3 and a molecular weight of 573.61 g/mol. Its IUPAC name is N-[(4aR,6R,8aS)-2-(cyclopropylmethyl)-8-hydroxy-4a-(3-methoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-2-(3,4-dichlorophenyl)-N-(2-methylpropyl)acetamide.
| Compound Name | N-[(4aR,6R,8aS)-2-(cyclopropylmethyl)-8-hydroxy-4a-(3-methoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-2-(3,4-dichlorophenyl)-N-(2-methylpropyl)acetamide |
|---|---|
| PubChem CID | 67728718 |
| Molecular Formula | C32H42Cl2N2O3 |
| Molecular Weight | 573.61 g/mol |
| Exact Mass | 572.26 |
| IUPAC Name | N-[(4aR,6R,8aS)-2-(cyclopropylmethyl)-8-hydroxy-4a-(3-methoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-2-(3,4-dichlorophenyl)-N-(2-methylpropyl)acetamide |
| SMILES | COc1cccc([C@@]23CCN(CC4CC4)C[C@H]2C(O)C[C@H](N(CC(C)C)C(=O)Cc2ccc(Cl)c(Cl)c2)C3)c1 |
| InChI | InChI=1S/C32H42Cl2N2O3/c1-21(2)18-36(31(38)14-23-9-10-28(33)29(34)13-23)25-16-30(37)27-20-35(19-22-7-8-22)12-11-32(27,17-25)24-5-4-6-26(15-24)39-3/h4-6,9-10,13,15,21-22,25,27,30,37H,7-8,11-12,14,16-20H2,1-3H3/t25-,27-,30?,32-/m0/s1 |
| InChIKey | WGOYAMNEVOAMQB-FPAFPJHQSA-N |
| XLogP | 6.22 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.61 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |