C35H44Cl2N2O5 — CID 67728658
[4a-(3-acetyloxyphenyl)-2-(cyclopropylmethyl)-6-[[2-(3,4-dichlorophenyl)acetyl]-(2-methylpropyl)amino]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-8-yl] acetate (PubChem CID 67728658) has the molecular formula C35H44Cl2N2O5 and a molecular weight of 643.65 g/mol. Its IUPAC name is [4a-(3-acetyloxyphenyl)-2-(cyclopropylmethyl)-6-[[2-(3,4-dichlorophenyl)acetyl]-(2-methylpropyl)amino]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-8-yl] acetate.
| Compound Name | [4a-(3-acetyloxyphenyl)-2-(cyclopropylmethyl)-6-[[2-(3,4-dichlorophenyl)acetyl]-(2-methylpropyl)amino]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-8-yl] acetate |
|---|---|
| PubChem CID | 67728658 |
| Molecular Formula | C35H44Cl2N2O5 |
| Molecular Weight | 643.65 g/mol |
| Exact Mass | 642.26 |
| IUPAC Name | [4a-(3-acetyloxyphenyl)-2-(cyclopropylmethyl)-6-[[2-(3,4-dichlorophenyl)acetyl]-(2-methylpropyl)amino]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-8-yl] acetate |
| SMILES | CC(=O)Oc1cccc(C23CCN(CC4CC4)CC2C(OC(C)=O)CC(N(CC(C)C)C(=O)Cc2ccc(Cl)c(Cl)c2)C3)c1 |
| InChI | InChI=1S/C35H44Cl2N2O5/c1-22(2)19-39(34(42)15-26-10-11-31(36)32(37)14-26)28-17-33(44-24(4)41)30-21-38(20-25-8-9-25)13-12-35(30,18-28)27-6-5-7-29(16-27)43-23(3)40/h5-7,10-11,14,16,22,25,28,30,33H,8-9,12-13,15,17-21H2,1-4H3 |
| InChIKey | BCEAMCUNHUWZDM-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.65 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|