C30H38Cl2N2O4 — CID 67728243
[3-[(4aR,6R,8aS)-6-[[2-(3,4-dichlorophenyl)acetyl]-(2-methylpropyl)amino]-8-hydroxy-2-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]phenyl] acetate (PubChem CID 67728243) has the molecular formula C30H38Cl2N2O4 and a molecular weight of 561.55 g/mol. Its IUPAC name is [3-[(4aR,6R,8aS)-6-[[2-(3,4-dichlorophenyl)acetyl]-(2-methylpropyl)amino]-8-hydroxy-2-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]phenyl] acetate.
| Compound Name | [3-[(4aR,6R,8aS)-6-[[2-(3,4-dichlorophenyl)acetyl]-(2-methylpropyl)amino]-8-hydroxy-2-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]phenyl] acetate |
|---|---|
| PubChem CID | 67728243 |
| Molecular Formula | C30H38Cl2N2O4 |
| Molecular Weight | 561.55 g/mol |
| Exact Mass | 560.22 |
| IUPAC Name | [3-[(4aR,6R,8aS)-6-[[2-(3,4-dichlorophenyl)acetyl]-(2-methylpropyl)amino]-8-hydroxy-2-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc([C@@]23CCN(C)C[C@H]2C(O)C[C@H](N(CC(C)C)C(=O)Cc2ccc(Cl)c(Cl)c2)C3)c1 |
| InChI | InChI=1S/C30H38Cl2N2O4/c1-19(2)17-34(29(37)13-21-8-9-26(31)27(32)12-21)23-15-28(36)25-18-33(4)11-10-30(25,16-23)22-6-5-7-24(14-22)38-20(3)35/h5-9,12,14,19,23,25,28,36H,10-11,13,15-18H2,1-4H3/t23-,25-,28?,30-/m0/s1 |
| InChIKey | GWTWSDUNDZWZLJ-ZFSUKVCLSA-N |
| XLogP | 5.36 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.55 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|