C31H40Cl2N2O3 — CID 67728473
N-[(4aR,6R,8aS)-8-hydroxy-4a-(3-methoxyphenyl)-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-2-(3,4-dichlorophenyl)-N-(2-methylpropyl)acetamide (PubChem CID 67728473) has the molecular formula C31H40Cl2N2O3 and a molecular weight of 559.58 g/mol. Its IUPAC name is N-[(4aR,6R,8aS)-8-hydroxy-4a-(3-methoxyphenyl)-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-2-(3,4-dichlorophenyl)-N-(2-methylpropyl)acetamide.
| Compound Name | N-[(4aR,6R,8aS)-8-hydroxy-4a-(3-methoxyphenyl)-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-2-(3,4-dichlorophenyl)-N-(2-methylpropyl)acetamide |
|---|---|
| PubChem CID | 67728473 |
| Molecular Formula | C31H40Cl2N2O3 |
| Molecular Weight | 559.58 g/mol |
| Exact Mass | 558.24 |
| IUPAC Name | N-[(4aR,6R,8aS)-8-hydroxy-4a-(3-methoxyphenyl)-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-2-(3,4-dichlorophenyl)-N-(2-methylpropyl)acetamide |
| SMILES | C=CCN1CC[C@@]2(c3cccc(OC)c3)C[C@@H](N(CC(C)C)C(=O)Cc3ccc(Cl)c(Cl)c3)CC(O)[C@@H]2C1 |
| InChI | InChI=1S/C31H40Cl2N2O3/c1-5-12-34-13-11-31(23-7-6-8-25(16-23)38-4)18-24(17-29(36)26(31)20-34)35(19-21(2)3)30(37)15-22-9-10-27(32)28(33)14-22/h5-10,14,16,21,24,26,29,36H,1,11-13,15,17-20H2,2-4H3/t24-,26-,29?,31-/m0/s1 |
| InChIKey | RNLLALHAGKVIEC-ZZYVWBIFSA-N |
| XLogP | 6.00 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.58 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|