C28H34Cl2N2O4 — CID 67728805
[3-[(4aR,6S,8aS)-6-[[2-(3,4-dichlorophenyl)acetyl]-methylamino]-8-methoxy-2-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]phenyl] acetate (PubChem CID 67728805) has the molecular formula C28H34Cl2N2O4 and a molecular weight of 533.50 g/mol. Its IUPAC name is [3-[(4aR,6S,8aS)-6-[[2-(3,4-dichlorophenyl)acetyl]-methylamino]-8-methoxy-2-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]phenyl] acetate.
| Compound Name | [3-[(4aR,6S,8aS)-6-[[2-(3,4-dichlorophenyl)acetyl]-methylamino]-8-methoxy-2-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]phenyl] acetate |
|---|---|
| PubChem CID | 67728805 |
| Molecular Formula | C28H34Cl2N2O4 |
| Molecular Weight | 533.50 g/mol |
| Exact Mass | 532.19 |
| IUPAC Name | [3-[(4aR,6S,8aS)-6-[[2-(3,4-dichlorophenyl)acetyl]-methylamino]-8-methoxy-2-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]phenyl] acetate |
| SMILES | COC1C[C@@H](N(C)C(=O)Cc2ccc(Cl)c(Cl)c2)C[C@]2(c3cccc(OC(C)=O)c3)CCN(C)C[C@@H]12 |
| InChI | InChI=1S/C28H34Cl2N2O4/c1-18(33)36-22-7-5-6-20(14-22)28-10-11-31(2)17-23(28)26(35-4)15-21(16-28)32(3)27(34)13-19-8-9-24(29)25(30)12-19/h5-9,12,14,21,23,26H,10-11,13,15-17H2,1-4H3/t21-,23+,26?,28+/m1/s1 |
| InChIKey | IGDYWKYEUJPPAB-XZDSOHDBSA-N |
| XLogP | 4.99 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.50 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|