C26H32Cl2N2O3 — CID 57137253
2-(3,4-dichlorophenyl)-N-[8-methoxy-4a-(3-methoxyphenyl)-2-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]acetamide (PubChem CID 57137253) has the molecular formula C26H32Cl2N2O3 and a molecular weight of 491.46 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-N-[8-methoxy-4a-(3-methoxyphenyl)-2-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]acetamide.
| Compound Name | 2-(3,4-dichlorophenyl)-N-[8-methoxy-4a-(3-methoxyphenyl)-2-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]acetamide |
|---|---|
| PubChem CID | 57137253 |
| Molecular Formula | C26H32Cl2N2O3 |
| Molecular Weight | 491.46 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-N-[8-methoxy-4a-(3-methoxyphenyl)-2-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]acetamide |
| SMILES | COc1cccc(C23CCN(C)CC2C(OC)CC(NC(=O)Cc2ccc(Cl)c(Cl)c2)C3)c1 |
| InChI | InChI=1S/C26H32Cl2N2O3/c1-30-10-9-26(18-5-4-6-20(13-18)32-2)15-19(14-24(33-3)21(26)16-30)29-25(31)12-17-7-8-22(27)23(28)11-17/h4-8,11,13,19,21,24H,9-10,12,14-16H2,1-3H3,(H,29,31) |
| InChIKey | PMVUHXCURKZGHU-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.46 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |