C23H29NO2 — CID 86754617
(4aS,8aR)-4a-(3-methoxyphenyl)-2-methyl-6-phenyl-3,4,5,7,8,8a-hexahydro-1H-isoquinolin-6-ol (PubChem CID 86754617) has the molecular formula C23H29NO2 and a molecular weight of 351.49 g/mol. Its IUPAC name is (4aS,8aR)-4a-(3-methoxyphenyl)-2-methyl-6-phenyl-3,4,5,7,8,8a-hexahydro-1H-isoquinolin-6-ol.
| Compound Name | (4aS,8aR)-4a-(3-methoxyphenyl)-2-methyl-6-phenyl-3,4,5,7,8,8a-hexahydro-1H-isoquinolin-6-ol |
|---|---|
| PubChem CID | 86754617 |
| Molecular Formula | C23H29NO2 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | (4aS,8aR)-4a-(3-methoxyphenyl)-2-methyl-6-phenyl-3,4,5,7,8,8a-hexahydro-1H-isoquinolin-6-ol |
| SMILES | COc1cccc([C@]23CCN(C)C[C@@H]2CCC(O)(c2ccccc2)C3)c1 |
| InChI | InChI=1S/C23H29NO2/c1-24-14-13-22(19-9-6-10-21(15-19)26-2)17-23(25,12-11-20(22)16-24)18-7-4-3-5-8-18/h3-10,15,20,25H,11-14,16-17H2,1-2H3/t20-,22+,23?/m0/s1 |
| InChIKey | TXNQLUIEJMYGAL-PDOMDSBESA-N |
| XLogP | 3.96 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |