C25H28N2O — CID 12074029
(4aS,12aR)-4a-(3-methoxyphenyl)-2,11-dimethyl-1,3,4,5,12,12a-hexahydropyrido[3,4-b]acridine (PubChem CID 12074029) has the molecular formula C25H28N2O and a molecular weight of 372.51 g/mol. Its IUPAC name is (4aS,12aR)-4a-(3-methoxyphenyl)-2,11-dimethyl-1,3,4,5,12,12a-hexahydropyrido[3,4-b]acridine.
| Compound Name | (4aS,12aR)-4a-(3-methoxyphenyl)-2,11-dimethyl-1,3,4,5,12,12a-hexahydropyrido[3,4-b]acridine |
|---|---|
| PubChem CID | 12074029 |
| Molecular Formula | C25H28N2O |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | (4aS,12aR)-4a-(3-methoxyphenyl)-2,11-dimethyl-1,3,4,5,12,12a-hexahydropyrido[3,4-b]acridine |
| SMILES | COc1cccc([C@]23CCN(C)C[C@@H]2Cc2c(nc4ccccc4c2C)C3)c1 |
| InChI | InChI=1S/C25H28N2O/c1-17-21-9-4-5-10-23(21)26-24-15-25(18-7-6-8-20(13-18)28-3)11-12-27(2)16-19(25)14-22(17)24/h4-10,13,19H,11-12,14-16H2,1-3H3/t19-,25+/m0/s1 |
| InChIKey | BKJZPGSUOQRSMA-UQBPGWFLSA-N |
| XLogP | 4.54 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |