C23H23BrN2O — CID 154135762
3-[(4aR,12aR)-10-bromo-2-methyl-1,3,4,5,12,12a-hexahydropyrido[3,4-b]acridin-4a-yl]phenol (PubChem CID 154135762) has the molecular formula C23H23BrN2O and a molecular weight of 423.35 g/mol. Its IUPAC name is 3-[(4aR,12aR)-10-bromo-2-methyl-1,3,4,5,12,12a-hexahydropyrido[3,4-b]acridin-4a-yl]phenol.
| Compound Name | 3-[(4aR,12aR)-10-bromo-2-methyl-1,3,4,5,12,12a-hexahydropyrido[3,4-b]acridin-4a-yl]phenol |
|---|---|
| PubChem CID | 154135762 |
| Molecular Formula | C23H23BrN2O |
| Molecular Weight | 423.35 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | 3-[(4aR,12aR)-10-bromo-2-methyl-1,3,4,5,12,12a-hexahydropyrido[3,4-b]acridin-4a-yl]phenol |
| SMILES | CN1CC[C@@]2(c3cccc(O)c3)Cc3nc4cccc(Br)c4cc3C[C@H]2C1 |
| InChI | InChI=1S/C23H23BrN2O/c1-26-9-8-23(16-4-2-5-18(27)12-16)13-22-15(10-17(23)14-26)11-19-20(24)6-3-7-21(19)25-22/h2-7,11-12,17,27H,8-10,13-14H2,1H3/t17-,23-/m0/s1 |
| InChIKey | WGYCZWSNWFUSNL-SBUREZEXSA-N |
| XLogP | 4.69 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.35 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |