C26H27ClN2O — CID 154127432
3-[(4aR,12aR)-7-chloro-2-(cyclopropylmethyl)-1,3,4,5,12,12a-hexahydropyrido[3,4-b]acridin-4a-yl]phenol (PubChem CID 154127432) has the molecular formula C26H27ClN2O and a molecular weight of 418.97 g/mol. Its IUPAC name is 3-[(4aR,12aR)-7-chloro-2-(cyclopropylmethyl)-1,3,4,5,12,12a-hexahydropyrido[3,4-b]acridin-4a-yl]phenol.
| Compound Name | 3-[(4aR,12aR)-7-chloro-2-(cyclopropylmethyl)-1,3,4,5,12,12a-hexahydropyrido[3,4-b]acridin-4a-yl]phenol |
|---|---|
| PubChem CID | 154127432 |
| Molecular Formula | C26H27ClN2O |
| Molecular Weight | 418.97 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 3-[(4aR,12aR)-7-chloro-2-(cyclopropylmethyl)-1,3,4,5,12,12a-hexahydropyrido[3,4-b]acridin-4a-yl]phenol |
| SMILES | Oc1cccc([C@@]23CCN(CC4CC4)C[C@@H]2Cc2cc4cccc(Cl)c4nc2C3)c1 |
| InChI | InChI=1S/C26H27ClN2O/c27-23-6-1-3-18-11-19-12-21-16-29(15-17-7-8-17)10-9-26(21,14-24(19)28-25(18)23)20-4-2-5-22(30)13-20/h1-6,11,13,17,21,30H,7-10,12,14-16H2/t21-,26-/m0/s1 |
| InChIKey | ZFHVODQLVSHKNQ-LVXARBLLSA-N |
| XLogP | 5.36 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.97 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |