C28H32N2O — CID 154125340
(4aR,12aR)-2-(cyclopropylmethyl)-4a-(3-methoxyphenyl)-10-methyl-1,3,4,5,12,12a-hexahydropyrido[3,4-b]acridine (PubChem CID 154125340) has the molecular formula C28H32N2O and a molecular weight of 412.58 g/mol. Its IUPAC name is (4aR,12aR)-2-(cyclopropylmethyl)-4a-(3-methoxyphenyl)-10-methyl-1,3,4,5,12,12a-hexahydropyrido[3,4-b]acridine.
| Compound Name | (4aR,12aR)-2-(cyclopropylmethyl)-4a-(3-methoxyphenyl)-10-methyl-1,3,4,5,12,12a-hexahydropyrido[3,4-b]acridine |
|---|---|
| PubChem CID | 154125340 |
| Molecular Formula | C28H32N2O |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | (4aR,12aR)-2-(cyclopropylmethyl)-4a-(3-methoxyphenyl)-10-methyl-1,3,4,5,12,12a-hexahydropyrido[3,4-b]acridine |
| SMILES | COc1cccc([C@@]23CCN(CC4CC4)C[C@@H]2Cc2cc4c(C)cccc4nc2C3)c1 |
| InChI | InChI=1S/C28H32N2O/c1-19-5-3-8-26-25(19)14-21-13-23-18-30(17-20-9-10-20)12-11-28(23,16-27(21)29-26)22-6-4-7-24(15-22)31-2/h3-8,14-15,20,23H,9-13,16-18H2,1-2H3/t23-,28-/m0/s1 |
| InChIKey | LHDZGTIMEVKTAX-FIPFOOKPSA-N |
| XLogP | 5.32 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |