C21H29NO — CID 22798950
(3aS,7aS)-2-(cyclopropylmethyl)-7a-(3-methoxyphenyl)-5,6-dimethyl-3,3a,4,7-tetrahydro-1H-isoindole (PubChem CID 22798950) has the molecular formula C21H29NO and a molecular weight of 311.47 g/mol. Its IUPAC name is (3aS,7aS)-2-(cyclopropylmethyl)-7a-(3-methoxyphenyl)-5,6-dimethyl-3,3a,4,7-tetrahydro-1H-isoindole.
| Compound Name | (3aS,7aS)-2-(cyclopropylmethyl)-7a-(3-methoxyphenyl)-5,6-dimethyl-3,3a,4,7-tetrahydro-1H-isoindole |
|---|---|
| PubChem CID | 22798950 |
| Molecular Formula | C21H29NO |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | (3aS,7aS)-2-(cyclopropylmethyl)-7a-(3-methoxyphenyl)-5,6-dimethyl-3,3a,4,7-tetrahydro-1H-isoindole |
| SMILES | COc1cccc([C@]23CC(C)=C(C)C[C@@H]2CN(CC2CC2)C3)c1 |
| InChI | InChI=1S/C21H29NO/c1-15-9-19-13-22(12-17-7-8-17)14-21(19,11-16(15)2)18-5-4-6-20(10-18)23-3/h4-6,10,17,19H,7-9,11-14H2,1-3H3/t19-,21-/m1/s1 |
| InChIKey | LUSQMDBOCVCQHZ-TZIWHRDSSA-N |
| XLogP | 4.41 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|