C18H25NO2 — CID 10827156
(4aR,8aS)-2-ethyl-4a-(3-methoxyphenyl)-3,4,5,7,8,8a-hexahydro-1H-isoquinolin-6-one (PubChem CID 10827156) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is (4aR,8aS)-2-ethyl-4a-(3-methoxyphenyl)-3,4,5,7,8,8a-hexahydro-1H-isoquinolin-6-one.
| Compound Name | (4aR,8aS)-2-ethyl-4a-(3-methoxyphenyl)-3,4,5,7,8,8a-hexahydro-1H-isoquinolin-6-one |
|---|---|
| PubChem CID | 10827156 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | (4aR,8aS)-2-ethyl-4a-(3-methoxyphenyl)-3,4,5,7,8,8a-hexahydro-1H-isoquinolin-6-one |
| SMILES | CCN1CC[C@@]2(c3cccc(OC)c3)CC(=O)CC[C@@H]2C1 |
| InChI | InChI=1S/C18H25NO2/c1-3-19-10-9-18(12-16(20)8-7-15(18)13-19)14-5-4-6-17(11-14)21-2/h4-6,11,15H,3,7-10,12-13H2,1-2H3/t15-,18+/m1/s1 |
| InChIKey | YKLOUKZAIKUCQL-QAPCUYQASA-N |
| XLogP | 3.03 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |