C22H29N3O2 — CID 18936223
6-ethyl-8a-(3-methoxyphenyl)-3-methyl-4,4a,5,7,8,9-hexahydro-1H-pyrrolo[2,3-g]isoquinoline-2-carboxamide (PubChem CID 18936223) has the molecular formula C22H29N3O2 and a molecular weight of 367.49 g/mol. Its IUPAC name is 6-ethyl-8a-(3-methoxyphenyl)-3-methyl-4,4a,5,7,8,9-hexahydro-1H-pyrrolo[2,3-g]isoquinoline-2-carboxamide.
| Compound Name | 6-ethyl-8a-(3-methoxyphenyl)-3-methyl-4,4a,5,7,8,9-hexahydro-1H-pyrrolo[2,3-g]isoquinoline-2-carboxamide |
|---|---|
| PubChem CID | 18936223 |
| Molecular Formula | C22H29N3O2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | 6-ethyl-8a-(3-methoxyphenyl)-3-methyl-4,4a,5,7,8,9-hexahydro-1H-pyrrolo[2,3-g]isoquinoline-2-carboxamide |
| SMILES | CCN1CCC2(c3cccc(OC)c3)Cc3[nH]c(C(N)=O)c(C)c3CC2C1 |
| InChI | InChI=1S/C22H29N3O2/c1-4-25-9-8-22(15-6-5-7-17(10-15)27-3)12-19-18(11-16(22)13-25)14(2)20(24-19)21(23)26/h5-7,10,16,24H,4,8-9,11-13H2,1-3H3,(H2,23,26) |
| InChIKey | OCKCZJVDLJHFLU-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |