C29H38ClN3O3 — CID 18936230
N,N-diethyl-6-(furan-2-ylmethyl)-8a-(3-methoxyphenyl)-3-methyl-4,4a,5,7,8,9-hexahydro-1H-pyrrolo[2,3-g]isoquinoline-2-carboxamide;hydrochloride (PubChem CID 18936230) has the molecular formula C29H38ClN3O3 and a molecular weight of 512.09 g/mol. Its IUPAC name is N,N-diethyl-6-(furan-2-ylmethyl)-8a-(3-methoxyphenyl)-3-methyl-4,4a,5,7,8,9-hexahydro-1H-pyrrolo[2,3-g]isoquinoline-2-carboxamide;hydrochloride.
| Compound Name | N,N-diethyl-6-(furan-2-ylmethyl)-8a-(3-methoxyphenyl)-3-methyl-4,4a,5,7,8,9-hexahydro-1H-pyrrolo[2,3-g]isoquinoline-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 18936230 |
| Molecular Formula | C29H38ClN3O3 |
| Molecular Weight | 512.09 g/mol |
| Exact Mass | 511.26 |
| IUPAC Name | N,N-diethyl-6-(furan-2-ylmethyl)-8a-(3-methoxyphenyl)-3-methyl-4,4a,5,7,8,9-hexahydro-1H-pyrrolo[2,3-g]isoquinoline-2-carboxamide;hydrochloride |
| SMILES | CCN(CC)C(=O)c1[nH]c2c(c1C)CC1CN(Cc3ccco3)CCC1(c1cccc(OC)c1)C2.Cl |
| InChI | InChI=1S/C29H37N3O3.ClH/c1-5-32(6-2)28(33)27-20(3)25-16-22-18-31(19-24-11-8-14-35-24)13-12-29(22,17-26(25)30-27)21-9-7-10-23(15-21)34-4;/h7-11,14-15,22,30H,5-6,12-13,16-19H2,1-4H3;1H |
| InChIKey | KLUAJIBIXORVHP-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 61.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.09 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |