C30H32N2O — CID 22846975
(4aR)-2-benzyl-4a-(3-methoxyphenyl)-10-methyl-3,4,5,6,11,11a-hexahydro-1H-pyrido[4,3-b]carbazole (PubChem CID 22846975) has the molecular formula C30H32N2O and a molecular weight of 436.60 g/mol. Its IUPAC name is (4aR)-2-benzyl-4a-(3-methoxyphenyl)-10-methyl-3,4,5,6,11,11a-hexahydro-1H-pyrido[4,3-b]carbazole.
| Compound Name | (4aR)-2-benzyl-4a-(3-methoxyphenyl)-10-methyl-3,4,5,6,11,11a-hexahydro-1H-pyrido[4,3-b]carbazole |
|---|---|
| PubChem CID | 22846975 |
| Molecular Formula | C30H32N2O |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | (4aR)-2-benzyl-4a-(3-methoxyphenyl)-10-methyl-3,4,5,6,11,11a-hexahydro-1H-pyrido[4,3-b]carbazole |
| SMILES | COc1cccc([C@@]23CCN(Cc4ccccc4)CC2Cc2c([nH]c4cccc(C)c24)C3)c1 |
| InChI | InChI=1S/C30H32N2O/c1-21-8-6-13-27-29(21)26-17-24-20-32(19-22-9-4-3-5-10-22)15-14-30(24,18-28(26)31-27)23-11-7-12-25(16-23)33-2/h3-13,16,24,31H,14-15,17-20H2,1-2H3/t24?,30-/m0/s1 |
| InChIKey | RVVCQLNVZHCRNT-FZNWDQQTSA-N |
| XLogP | 6.04 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |