C30H32N2O2 — CID 67692994
(4aS,11aR)-2-benzyl-4a-(3-methoxyphenyl)-10-methyl-1,3,4,5,6,11-hexahydropyrido[4,3-b]carbazol-11a-ol (PubChem CID 67692994) has the molecular formula C30H32N2O2 and a molecular weight of 452.60 g/mol. Its IUPAC name is (4aS,11aR)-2-benzyl-4a-(3-methoxyphenyl)-10-methyl-1,3,4,5,6,11-hexahydropyrido[4,3-b]carbazol-11a-ol.
| Compound Name | (4aS,11aR)-2-benzyl-4a-(3-methoxyphenyl)-10-methyl-1,3,4,5,6,11-hexahydropyrido[4,3-b]carbazol-11a-ol |
|---|---|
| PubChem CID | 67692994 |
| Molecular Formula | C30H32N2O2 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.25 |
| IUPAC Name | (4aS,11aR)-2-benzyl-4a-(3-methoxyphenyl)-10-methyl-1,3,4,5,6,11-hexahydropyrido[4,3-b]carbazol-11a-ol |
| SMILES | COc1cccc([C@@]23CCN(Cc4ccccc4)C[C@@]2(O)Cc2c([nH]c4cccc(C)c24)C3)c1 |
| InChI | InChI=1S/C30H32N2O2/c1-21-8-6-13-26-28(21)25-17-30(33)20-32(19-22-9-4-3-5-10-22)15-14-29(30,18-27(25)31-26)23-11-7-12-24(16-23)34-2/h3-13,16,31,33H,14-15,17-20H2,1-2H3/t29-,30-/m0/s1 |
| InChIKey | PZXDYKRMXLGJQP-KYJUHHDHSA-N |
| XLogP | 5.16 |
| TPSA | 48.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |