C28H27ClN2O2 — CID 67692843
(4aS,11aR)-2-benzyl-10-chloro-4a-(3-hydroxyphenyl)-1,3,4,5,6,11-hexahydropyrido[4,3-b]carbazol-11a-ol (PubChem CID 67692843) has the molecular formula C28H27ClN2O2 and a molecular weight of 458.99 g/mol. Its IUPAC name is (4aS,11aR)-2-benzyl-10-chloro-4a-(3-hydroxyphenyl)-1,3,4,5,6,11-hexahydropyrido[4,3-b]carbazol-11a-ol.
| Compound Name | (4aS,11aR)-2-benzyl-10-chloro-4a-(3-hydroxyphenyl)-1,3,4,5,6,11-hexahydropyrido[4,3-b]carbazol-11a-ol |
|---|---|
| PubChem CID | 67692843 |
| Molecular Formula | C28H27ClN2O2 |
| Molecular Weight | 458.99 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | (4aS,11aR)-2-benzyl-10-chloro-4a-(3-hydroxyphenyl)-1,3,4,5,6,11-hexahydropyrido[4,3-b]carbazol-11a-ol |
| SMILES | Oc1cccc([C@@]23CCN(Cc4ccccc4)C[C@@]2(O)Cc2c([nH]c4cccc(Cl)c24)C3)c1 |
| InChI | InChI=1S/C28H27ClN2O2/c29-23-10-5-11-24-26(23)22-15-28(33)18-31(17-19-6-2-1-3-7-19)13-12-27(28,16-25(22)30-24)20-8-4-9-21(32)14-20/h1-11,14,30,32-33H,12-13,15-18H2/t27-,28-/m0/s1 |
| InChIKey | PSXIYEROFBPCAA-NSOVKSMOSA-N |
| XLogP | 5.20 |
| TPSA | 59.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.99 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |