C24H25N3O4 — CID 67693366
(4aS,11aR)-4a-(3-hydroxyphenyl)-10-nitro-2-prop-2-enyl-1,3,4,5,6,11-hexahydropyrido[4,3-b]carbazol-11a-ol (PubChem CID 67693366) has the molecular formula C24H25N3O4 and a molecular weight of 419.48 g/mol. Its IUPAC name is (4aS,11aR)-4a-(3-hydroxyphenyl)-10-nitro-2-prop-2-enyl-1,3,4,5,6,11-hexahydropyrido[4,3-b]carbazol-11a-ol.
| Compound Name | (4aS,11aR)-4a-(3-hydroxyphenyl)-10-nitro-2-prop-2-enyl-1,3,4,5,6,11-hexahydropyrido[4,3-b]carbazol-11a-ol |
|---|---|
| PubChem CID | 67693366 |
| Molecular Formula | C24H25N3O4 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | (4aS,11aR)-4a-(3-hydroxyphenyl)-10-nitro-2-prop-2-enyl-1,3,4,5,6,11-hexahydropyrido[4,3-b]carbazol-11a-ol |
| SMILES | C=CCN1CC[C@@]2(c3cccc(O)c3)Cc3[nH]c4cccc([N+](=O)[O-])c4c3C[C@]2(O)C1 |
| InChI | InChI=1S/C24H25N3O4/c1-2-10-26-11-9-23(16-5-3-6-17(28)12-16)14-20-18(13-24(23,29)15-26)22-19(25-20)7-4-8-21(22)27(30)31/h2-8,12,25,28-29H,1,9-11,13-15H2/t23-,24-/m0/s1 |
| InChIKey | OOWNFTWZTCIJNW-ZEQRLZLVSA-N |
| XLogP | 3.44 |
| TPSA | 102.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|