C25H27FN2O2 — CID 19435695
9-fluoro-4a-(3-methoxyphenyl)-2-prop-2-enyl-1,3,4,5,6,11-hexahydropyrido[4,3-b]carbazol-11a-ol (PubChem CID 19435695) has the molecular formula C25H27FN2O2 and a molecular weight of 406.50 g/mol. Its IUPAC name is 9-fluoro-4a-(3-methoxyphenyl)-2-prop-2-enyl-1,3,4,5,6,11-hexahydropyrido[4,3-b]carbazol-11a-ol.
| Compound Name | 9-fluoro-4a-(3-methoxyphenyl)-2-prop-2-enyl-1,3,4,5,6,11-hexahydropyrido[4,3-b]carbazol-11a-ol |
|---|---|
| PubChem CID | 19435695 |
| Molecular Formula | C25H27FN2O2 |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | 9-fluoro-4a-(3-methoxyphenyl)-2-prop-2-enyl-1,3,4,5,6,11-hexahydropyrido[4,3-b]carbazol-11a-ol |
| SMILES | C=CCN1CCC2(c3cccc(OC)c3)Cc3[nH]c4ccc(F)cc4c3CC2(O)C1 |
| InChI | InChI=1S/C25H27FN2O2/c1-3-10-28-11-9-24(17-5-4-6-19(12-17)30-2)15-23-21(14-25(24,29)16-28)20-13-18(26)7-8-22(20)27-23/h3-8,12-13,27,29H,1,9-11,14-16H2,2H3 |
| InChIKey | VEZHJWPSJSCKMT-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 48.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|