C23H25FN2O2 — CID 67693336
(4aS,11aR)-8-fluoro-4a-(3-methoxyphenyl)-2-methyl-1,3,4,5,6,11-hexahydropyrido[4,3-b]carbazol-11a-ol (PubChem CID 67693336) has the molecular formula C23H25FN2O2 and a molecular weight of 380.46 g/mol. Its IUPAC name is (4aS,11aR)-8-fluoro-4a-(3-methoxyphenyl)-2-methyl-1,3,4,5,6,11-hexahydropyrido[4,3-b]carbazol-11a-ol.
| Compound Name | (4aS,11aR)-8-fluoro-4a-(3-methoxyphenyl)-2-methyl-1,3,4,5,6,11-hexahydropyrido[4,3-b]carbazol-11a-ol |
|---|---|
| PubChem CID | 67693336 |
| Molecular Formula | C23H25FN2O2 |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | (4aS,11aR)-8-fluoro-4a-(3-methoxyphenyl)-2-methyl-1,3,4,5,6,11-hexahydropyrido[4,3-b]carbazol-11a-ol |
| SMILES | COc1cccc([C@@]23CCN(C)C[C@@]2(O)Cc2c([nH]c4cc(F)ccc24)C3)c1 |
| InChI | InChI=1S/C23H25FN2O2/c1-26-9-8-22(15-4-3-5-17(10-15)28-2)13-21-19(12-23(22,27)14-26)18-7-6-16(24)11-20(18)25-21/h3-7,10-11,25,27H,8-9,12-14H2,1-2H3/t22-,23-/m0/s1 |
| InChIKey | SCTILOVPWDYBDZ-GOTSBHOMSA-N |
| XLogP | 3.42 |
| TPSA | 48.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|