C23H27NO3 — CID 67693160
(4aR,8aS)-2-benzyl-8a-hydroxy-4a-(3-methoxyphenyl)-1,3,4,5,7,8-hexahydroisoquinolin-6-one (PubChem CID 67693160) has the molecular formula C23H27NO3 and a molecular weight of 365.47 g/mol. Its IUPAC name is (4aR,8aS)-2-benzyl-8a-hydroxy-4a-(3-methoxyphenyl)-1,3,4,5,7,8-hexahydroisoquinolin-6-one.
| Compound Name | (4aR,8aS)-2-benzyl-8a-hydroxy-4a-(3-methoxyphenyl)-1,3,4,5,7,8-hexahydroisoquinolin-6-one |
|---|---|
| PubChem CID | 67693160 |
| Molecular Formula | C23H27NO3 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | (4aR,8aS)-2-benzyl-8a-hydroxy-4a-(3-methoxyphenyl)-1,3,4,5,7,8-hexahydroisoquinolin-6-one |
| SMILES | COc1cccc([C@]23CCN(Cc4ccccc4)C[C@]2(O)CCC(=O)C3)c1 |
| InChI | InChI=1S/C23H27NO3/c1-27-21-9-5-8-19(14-21)22-12-13-24(16-18-6-3-2-4-7-18)17-23(22,26)11-10-20(25)15-22/h2-9,14,26H,10-13,15-17H2,1H3/t22-,23-/m1/s1 |
| InChIKey | MNBCSMNLDMEWGQ-DHIUTWEWSA-N |
| XLogP | 3.32 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |