C19H25NO3 — CID 70338052
(4aS,8aR)-2-(cyclopropylmethyl)-8a-hydroxy-4a-(3-hydroxyphenyl)-1,3,4,5,7,8-hexahydroisoquinolin-6-one (PubChem CID 70338052) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is (4aS,8aR)-2-(cyclopropylmethyl)-8a-hydroxy-4a-(3-hydroxyphenyl)-1,3,4,5,7,8-hexahydroisoquinolin-6-one.
| Compound Name | (4aS,8aR)-2-(cyclopropylmethyl)-8a-hydroxy-4a-(3-hydroxyphenyl)-1,3,4,5,7,8-hexahydroisoquinolin-6-one |
|---|---|
| PubChem CID | 70338052 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | (4aS,8aR)-2-(cyclopropylmethyl)-8a-hydroxy-4a-(3-hydroxyphenyl)-1,3,4,5,7,8-hexahydroisoquinolin-6-one |
| SMILES | O=C1CC[C@]2(O)CN(CC3CC3)CC[C@@]2(c2cccc(O)c2)C1 |
| InChI | InChI=1S/C19H25NO3/c21-16-3-1-2-15(10-16)18-8-9-20(12-14-4-5-14)13-19(18,23)7-6-17(22)11-18/h1-3,10,14,21,23H,4-9,11-13H2/t18-,19-/m0/s1 |
| InChIKey | MKKAMEYDDUYWFF-OALUTQOASA-N |
| XLogP | 2.23 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |