C25H30N2O3 — CID 18662086
N-[(4aS,6S,8aR)-8a-hydroxy-4a-(3-hydroxyphenyl)-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]benzamide (PubChem CID 18662086) has the molecular formula C25H30N2O3 and a molecular weight of 406.53 g/mol. Its IUPAC name is N-[(4aS,6S,8aR)-8a-hydroxy-4a-(3-hydroxyphenyl)-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]benzamide.
| Compound Name | N-[(4aS,6S,8aR)-8a-hydroxy-4a-(3-hydroxyphenyl)-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]benzamide |
|---|---|
| PubChem CID | 18662086 |
| Molecular Formula | C25H30N2O3 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | N-[(4aS,6S,8aR)-8a-hydroxy-4a-(3-hydroxyphenyl)-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]benzamide |
| SMILES | C=CCN1CC[C@@]2(c3cccc(O)c3)C[C@@H](NC(=O)c3ccccc3)CC[C@]2(O)C1 |
| InChI | InChI=1S/C25H30N2O3/c1-2-14-27-15-13-24(20-9-6-10-22(28)16-20)17-21(11-12-25(24,30)18-27)26-23(29)19-7-4-3-5-8-19/h2-10,16,21,28,30H,1,11-15,17-18H2,(H,26,29)/t21-,24-,25-/m0/s1 |
| InChIKey | RBRNSWQMQOFBDB-TUSQITKMSA-N |
| XLogP | 3.24 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|