C29H34N2O5 — CID 70340424
[3-[(6R)-8a-acetyloxy-6-benzamido-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-4a-yl]phenyl] acetate (PubChem CID 70340424) has the molecular formula C29H34N2O5 and a molecular weight of 490.60 g/mol. Its IUPAC name is [3-[(6R)-8a-acetyloxy-6-benzamido-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-4a-yl]phenyl] acetate.
| Compound Name | [3-[(6R)-8a-acetyloxy-6-benzamido-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-4a-yl]phenyl] acetate |
|---|---|
| PubChem CID | 70340424 |
| Molecular Formula | C29H34N2O5 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.25 |
| IUPAC Name | [3-[(6R)-8a-acetyloxy-6-benzamido-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-4a-yl]phenyl] acetate |
| SMILES | C=CCN1CCC2(c3cccc(OC(C)=O)c3)C[C@H](NC(=O)c3ccccc3)CCC2(OC(C)=O)C1 |
| InChI | InChI=1S/C29H34N2O5/c1-4-16-31-17-15-28(24-11-8-12-26(18-24)35-21(2)32)19-25(13-14-29(28,20-31)36-22(3)33)30-27(34)23-9-6-5-7-10-23/h4-12,18,25H,1,13-17,19-20H2,2-3H3,(H,30,34)/t25-,28?,29?/m1/s1 |
| InChIKey | QQOWXKGZTXVQHD-DYHAMKINSA-N |
| XLogP | 4.03 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|